C22H13Cl2N3O3 — CID 6521608
4-[5-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]benzonitrile (PubChem CID 6521608) has the molecular formula C22H13Cl2N3O3 and a molecular weight of 438.27 g/mol. Its IUPAC name is 4-[5-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]benzonitrile.
| Compound Name | 4-[5-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 6521608 |
| Molecular Formula | C22H13Cl2N3O3 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 4-[5-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(/C=C3\NC(=O)N(Cc4ccc(Cl)c(Cl)c4)C3=O)o2)cc1 |
| InChI | InChI=1S/C22H13Cl2N3O3/c23-17-7-3-14(9-18(17)24)12-27-21(28)19(26-22(27)29)10-16-6-8-20(30-16)15-4-1-13(11-25)2-5-15/h1-10H,12H2,(H,26,29)/b19-10- |
| InChIKey | IOTOIZHVAMYJOC-GRSHGNNSSA-N |
| XLogP | 5.22 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|