C14H8Cl3N5O5 — CID 46803887
4-amino-3,5,6-trichloro-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide (PubChem CID 46803887) has the molecular formula C14H8Cl3N5O5 and a molecular weight of 432.61 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 46803887 |
| Molecular Formula | C14H8Cl3N5O5 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)N/N=C/c2cc3c(cc2[N+](=O)[O-])OCO3)c1Cl |
| InChI | InChI=1S/C14H8Cl3N5O5/c15-9-11(18)10(16)13(17)20-12(9)14(23)21-19-3-5-1-7-8(27-4-26-7)2-6(5)22(24)25/h1-3H,4H2,(H2,18,20)(H,21,23)/b19-3+ |
| InChIKey | HIRZRYWMWSWVSV-QBROUFQSSA-N |
| XLogP | 3.02 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|