C18H15N3O4 — CID 126274274
3-methyl-N-[(Z)-(5-nitro-2-prop-2-ynoxyphenyl)methylideneamino]benzamide (PubChem CID 126274274) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 3-methyl-N-[(Z)-(5-nitro-2-prop-2-ynoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-methyl-N-[(Z)-(5-nitro-2-prop-2-ynoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126274274 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-methyl-N-[(Z)-(5-nitro-2-prop-2-ynoxyphenyl)methylideneamino]benzamide |
| SMILES | C#CCOc1ccc([N+](=O)[O-])cc1/C=N\NC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C18H15N3O4/c1-3-9-25-17-8-7-16(21(23)24)11-15(17)12-19-20-18(22)14-6-4-5-13(2)10-14/h1,4-8,10-12H,9H2,2H3,(H,20,22)/b19-12- |
| InChIKey | ZQCDQBVIYHZAIE-UNOMPAQXSA-N |
| XLogP | 2.68 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|