C16H17N3O6 — CID 21370418
2-(2-methyl-1,3-dioxolan-2-yl)-N-[(E)-(5-nitro-2-prop-2-ynoxyphenyl)methylideneamino]acetamide (PubChem CID 21370418) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dioxolan-2-yl)-N-[(E)-(5-nitro-2-prop-2-ynoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-methyl-1,3-dioxolan-2-yl)-N-[(E)-(5-nitro-2-prop-2-ynoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 21370418 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-(2-methyl-1,3-dioxolan-2-yl)-N-[(E)-(5-nitro-2-prop-2-ynoxyphenyl)methylideneamino]acetamide |
| SMILES | C#CCOc1ccc([N+](=O)[O-])cc1/C=N/NC(=O)CC1(C)OCCO1 |
| InChI | InChI=1S/C16H17N3O6/c1-3-6-23-14-5-4-13(19(21)22)9-12(14)11-17-18-15(20)10-16(2)24-7-8-25-16/h1,4-5,9,11H,6-8,10H2,2H3,(H,18,20)/b17-11+ |
| InChIKey | OYZCEDOYLPHWNN-GZTJUZNOSA-N |
| XLogP | 1.21 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|