C30H24BrN3O2S — CID 25251093
N-[(E)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(2-methylquinolin-4-yl)sulfanylacetamide (PubChem CID 25251093) has the molecular formula C30H24BrN3O2S and a molecular weight of 570.51 g/mol. Its IUPAC name is N-[(E)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(2-methylquinolin-4-yl)sulfanylacetamide.
| Compound Name | N-[(E)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(2-methylquinolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 25251093 |
| Molecular Formula | C30H24BrN3O2S |
| Molecular Weight | 570.51 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | N-[(E)-[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(2-methylquinolin-4-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)N/N=C/c2c(OCc3cccc(Br)c3)ccc3ccccc23)c2ccccc2n1 |
| InChI | InChI=1S/C30H24BrN3O2S/c1-20-15-29(25-11-4-5-12-27(25)33-20)37-19-30(35)34-32-17-26-24-10-3-2-8-22(24)13-14-28(26)36-18-21-7-6-9-23(31)16-21/h2-17H,18-19H2,1H3,(H,34,35)/b32-17+ |
| InChIKey | UOCBUVBZBCWPPM-VTNSRFBWSA-N |
| XLogP | 7.28 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.51 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|