C30H29BrN2O3 — CID 3249643
N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(4-butylphenoxy)acetamide (PubChem CID 3249643) has the molecular formula C30H29BrN2O3 and a molecular weight of 545.48 g/mol. Its IUPAC name is N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(4-butylphenoxy)acetamide.
| Compound Name | N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(4-butylphenoxy)acetamide |
|---|---|
| PubChem CID | 3249643 |
| Molecular Formula | C30H29BrN2O3 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | N-[[2-[(3-bromophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-(4-butylphenoxy)acetamide |
| SMILES | CCCCc1ccc(OCC(=O)NN=Cc2c(OCc3cccc(Br)c3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C30H29BrN2O3/c1-2-3-7-22-12-15-26(16-13-22)35-21-30(34)33-32-19-28-27-11-5-4-9-24(27)14-17-29(28)36-20-23-8-6-10-25(31)18-23/h4-6,8-19H,2-3,7,20-21H2,1H3,(H,33,34) |
| InChIKey | OOQXBBREJNYRNL-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|