C14H21N3O4 — CID 94848685
N'-[(Z)-(5-methylfuran-2-yl)methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide (PubChem CID 94848685) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is N'-[(Z)-(5-methylfuran-2-yl)methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide.
| Compound Name | N'-[(Z)-(5-methylfuran-2-yl)methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide |
|---|---|
| PubChem CID | 94848685 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N'-[(Z)-(5-methylfuran-2-yl)methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide |
| SMILES | Cc1ccc(/C=N\NC(=O)C(=O)NCCCOC(C)C)o1 |
| InChI | InChI=1S/C14H21N3O4/c1-10(2)20-8-4-7-15-13(18)14(19)17-16-9-12-6-5-11(3)21-12/h5-6,9-10H,4,7-8H2,1-3H3,(H,15,18)(H,17,19)/b16-9- |
| InChIKey | RIYNOAXYMXTXLJ-SXGWCWSVSA-N |
| XLogP | 0.97 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|