C22H23F3IN3O4 — CID 4312607
N'-[(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide (PubChem CID 4312607) has the molecular formula C22H23F3IN3O4 and a molecular weight of 577.34 g/mol. Its IUPAC name is N'-[(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide.
| Compound Name | N'-[(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide |
|---|---|
| PubChem CID | 4312607 |
| Molecular Formula | C22H23F3IN3O4 |
| Molecular Weight | 577.34 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | N'-[(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]butanediamide |
| SMILES | COc1cc(C=NNC(=O)CCC(=O)Nc2cccc(C(F)(F)F)c2)cc(I)c1OC(C)C |
| InChI | InChI=1S/C22H23F3IN3O4/c1-13(2)33-21-17(26)9-14(10-18(21)32-3)12-27-29-20(31)8-7-19(30)28-16-6-4-5-15(11-16)22(23,24)25/h4-6,9-13H,7-8H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | PVMVKUOAQVWYEX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|