C17H17Cl3N2O2 — CID 110340085
N-[(E)-[3-ethoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]methanamine (PubChem CID 110340085) has the molecular formula C17H17Cl3N2O2 and a molecular weight of 387.69 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]methanamine.
| Compound Name | N-[(E)-[3-ethoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]methanamine |
|---|---|
| PubChem CID | 110340085 |
| Molecular Formula | C17H17Cl3N2O2 |
| Molecular Weight | 387.69 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[(2,3,6-trichlorophenyl)methoxy]phenyl]methylideneamino]methanamine |
| SMILES | CCOc1cc(/C=N/NC)ccc1OCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C17H17Cl3N2O2/c1-3-23-16-8-11(9-22-21-2)4-7-15(16)24-10-12-13(18)5-6-14(19)17(12)20/h4-9,21H,3,10H2,1-2H3/b22-9+ |
| InChIKey | KTJXJLBMHGZLSN-LSFURLLWSA-N |
| XLogP | 5.18 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.69 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|