C17H14Cl3FN2O2 — CID 3266836
N-[(2-chloro-6-fluorophenyl)methylideneamino]-4-(2,4-dichlorophenoxy)butanamide (PubChem CID 3266836) has the molecular formula C17H14Cl3FN2O2 and a molecular weight of 403.67 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methylideneamino]-4-(2,4-dichlorophenoxy)butanamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methylideneamino]-4-(2,4-dichlorophenoxy)butanamide |
|---|---|
| PubChem CID | 3266836 |
| Molecular Formula | C17H14Cl3FN2O2 |
| Molecular Weight | 403.67 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methylideneamino]-4-(2,4-dichlorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NN=Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H14Cl3FN2O2/c18-11-6-7-16(14(20)9-11)25-8-2-5-17(24)23-22-10-12-13(19)3-1-4-15(12)21/h1,3-4,6-7,9-10H,2,5,8H2,(H,23,24) |
| InChIKey | GYBZQHLFFQTGLG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|