C23H19ClIN3O5 — CID 4264998
3-[[4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid (PubChem CID 4264998) has the molecular formula C23H19ClIN3O5 and a molecular weight of 579.78 g/mol. Its IUPAC name is 3-[[4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 4264998 |
| Molecular Formula | C23H19ClIN3O5 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.01 |
| IUPAC Name | 3-[[4-[[(2-chloropyridine-3-carbonyl)hydrazinylidene]methyl]-2-ethoxy-6-iodophenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C=NNC(=O)c2cccnc2Cl)cc(I)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C23H19ClIN3O5/c1-2-32-19-11-15(12-27-28-22(29)17-7-4-8-26-21(17)24)10-18(25)20(19)33-13-14-5-3-6-16(9-14)23(30)31/h3-12H,2,13H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | LYOYCPRONXLNLO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|