C23H21Cl2N3O3 — CID 3912707
2-chloro-N-[[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]pyridine-3-carboxamide (PubChem CID 3912707) has the molecular formula C23H21Cl2N3O3 and a molecular weight of 458.35 g/mol. Its IUPAC name is 2-chloro-N-[[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3912707 |
| Molecular Formula | C23H21Cl2N3O3 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 2-chloro-N-[[3-chloro-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]pyridine-3-carboxamide |
| SMILES | CCOc1cc(C=NNC(=O)c2cccnc2Cl)cc(Cl)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C23H21Cl2N3O3/c1-3-30-20-12-17(13-27-28-23(29)18-8-5-9-26-22(18)25)11-19(24)21(20)31-14-16-7-4-6-15(2)10-16/h4-13H,3,14H2,1-2H3,(H,28,29) |
| InChIKey | ROOOAZWDOSINJP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|