C20H13Cl3IN3O2 — CID 3515448
2-chloro-N-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]pyridine-3-carboxamide (PubChem CID 3515448) has the molecular formula C20H13Cl3IN3O2 and a molecular weight of 560.61 g/mol. Its IUPAC name is 2-chloro-N-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3515448 |
| Molecular Formula | C20H13Cl3IN3O2 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 558.91 |
| IUPAC Name | 2-chloro-N-[[3,5-dichloro-4-[(4-iodophenyl)methoxy]phenyl]methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(NN=Cc1cc(Cl)c(OCc2ccc(I)cc2)c(Cl)c1)c1cccnc1Cl |
| InChI | InChI=1S/C20H13Cl3IN3O2/c21-16-8-13(10-26-27-20(28)15-2-1-7-25-19(15)23)9-17(22)18(16)29-11-12-3-5-14(24)6-4-12/h1-10H,11H2,(H,27,28) |
| InChIKey | JQMIKVIQIQSLMO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|