C24H16Br2ClN3O2 — CID 3291466
2-chloro-N-[[3,5-dibromo-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]pyridine-3-carboxamide (PubChem CID 3291466) has the molecular formula C24H16Br2ClN3O2 and a molecular weight of 573.67 g/mol. Its IUPAC name is 2-chloro-N-[[3,5-dibromo-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[[3,5-dibromo-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3291466 |
| Molecular Formula | C24H16Br2ClN3O2 |
| Molecular Weight | 573.67 g/mol |
| Exact Mass | 570.93 |
| IUPAC Name | 2-chloro-N-[[3,5-dibromo-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(NN=Cc1cc(Br)c(OCc2ccc3ccccc3c2)c(Br)c1)c1cccnc1Cl |
| InChI | InChI=1S/C24H16Br2ClN3O2/c25-20-11-16(13-29-30-24(31)19-6-3-9-28-23(19)27)12-21(26)22(20)32-14-15-7-8-17-4-1-2-5-18(17)10-15/h1-13H,14H2,(H,30,31) |
| InChIKey | DXLIUQBTOZIMGK-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.67 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|