C20H14BrClIN3O2 — CID 3927384
N-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-chloropyridine-3-carboxamide (PubChem CID 3927384) has the molecular formula C20H14BrClIN3O2 and a molecular weight of 570.61 g/mol. Its IUPAC name is N-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-chloropyridine-3-carboxamide.
| Compound Name | N-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 3927384 |
| Molecular Formula | C20H14BrClIN3O2 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 568.90 |
| IUPAC Name | N-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylideneamino]-2-chloropyridine-3-carboxamide |
| SMILES | O=C(NN=Cc1ccc(OCc2ccc(Br)cc2)c(I)c1)c1cccnc1Cl |
| InChI | InChI=1S/C20H14BrClIN3O2/c21-15-6-3-13(4-7-15)12-28-18-8-5-14(10-17(18)23)11-25-26-20(27)16-2-1-9-24-19(16)22/h1-11H,12H2,(H,26,27) |
| InChIKey | UXRQEIOGMUAFMW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|