C16H13ClIN3O2 — CID 4644187
2-chloro-N-[(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]pyridine-3-carboxamide (PubChem CID 4644187) has the molecular formula C16H13ClIN3O2 and a molecular weight of 441.66 g/mol. Its IUPAC name is 2-chloro-N-[(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4644187 |
| Molecular Formula | C16H13ClIN3O2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 440.97 |
| IUPAC Name | 2-chloro-N-[(3-iodo-4-prop-2-enoxyphenyl)methylideneamino]pyridine-3-carboxamide |
| SMILES | C=CCOc1ccc(C=NNC(=O)c2cccnc2Cl)cc1I |
| InChI | InChI=1S/C16H13ClIN3O2/c1-2-8-23-14-6-5-11(9-13(14)18)10-20-21-16(22)12-4-3-7-19-15(12)17/h2-7,9-10H,1,8H2,(H,21,22) |
| InChIKey | ZARLIIXZPMFJRQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|