C11H12Cl2O3 — CID 82091052
2-[2-(2,6-dichlorophenoxy)ethyl]-1,3-dioxolane (PubChem CID 82091052) has the molecular formula C11H12Cl2O3 and a molecular weight of 263.12 g/mol. Its IUPAC name is 2-[2-(2,6-dichlorophenoxy)ethyl]-1,3-dioxolane.
| Compound Name | 2-[2-(2,6-dichlorophenoxy)ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 82091052 |
| Molecular Formula | C11H12Cl2O3 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 2-[2-(2,6-dichlorophenoxy)ethyl]-1,3-dioxolane |
| SMILES | Clc1cccc(Cl)c1OCCC1OCCO1 |
| InChI | InChI=1S/C11H12Cl2O3/c12-8-2-1-3-9(13)11(8)16-5-4-10-14-6-7-15-10/h1-3,10H,4-7H2 |
| InChIKey | VSEKLQXWUWRWCD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |