C10H11ClO3 — CID 82078485
2-[(2-chlorophenoxy)methyl]-1,3-dioxolane (PubChem CID 82078485) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-[(2-chlorophenoxy)methyl]-1,3-dioxolane.
| Compound Name | 2-[(2-chlorophenoxy)methyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 82078485 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-[(2-chlorophenoxy)methyl]-1,3-dioxolane |
| SMILES | Clc1ccccc1OCC1OCCO1 |
| InChI | InChI=1S/C10H11ClO3/c11-8-3-1-2-4-9(8)14-7-10-12-5-6-13-10/h1-4,10H,5-7H2 |
| InChIKey | QYJGEURLIRQHOL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |