C11H12ClFO3 — CID 82086347
2-[2-(2-chloro-4-fluorophenoxy)ethyl]-1,3-dioxolane (PubChem CID 82086347) has the molecular formula C11H12ClFO3 and a molecular weight of 246.66 g/mol. Its IUPAC name is 2-[2-(2-chloro-4-fluorophenoxy)ethyl]-1,3-dioxolane.
| Compound Name | 2-[2-(2-chloro-4-fluorophenoxy)ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 82086347 |
| Molecular Formula | C11H12ClFO3 |
| Molecular Weight | 246.66 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-[2-(2-chloro-4-fluorophenoxy)ethyl]-1,3-dioxolane |
| SMILES | Fc1ccc(OCCC2OCCO2)c(Cl)c1 |
| InChI | InChI=1S/C11H12ClFO3/c12-9-7-8(13)1-2-10(9)14-4-3-11-15-5-6-16-11/h1-2,7,11H,3-6H2 |
| InChIKey | LFKWXPKHZIZKLX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |