C11H10ClFINO2 — CID 70235439
(4S)-4-[2-(2-chloro-4-fluorophenoxy)ethyl]-2-iodo-4,5-dihydro-1,3-oxazole (PubChem CID 70235439) has the molecular formula C11H10ClFINO2 and a molecular weight of 369.56 g/mol. Its IUPAC name is (4S)-4-[2-(2-chloro-4-fluorophenoxy)ethyl]-2-iodo-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-[2-(2-chloro-4-fluorophenoxy)ethyl]-2-iodo-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 70235439 |
| Molecular Formula | C11H10ClFINO2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | (4S)-4-[2-(2-chloro-4-fluorophenoxy)ethyl]-2-iodo-4,5-dihydro-1,3-oxazole |
| SMILES | Fc1ccc(OCC[C@H]2COC(I)=N2)c(Cl)c1 |
| InChI | InChI=1S/C11H10ClFINO2/c12-9-5-7(13)1-2-10(9)16-4-3-8-6-17-11(14)15-8/h1-2,5,8H,3-4,6H2/t8-/m0/s1 |
| InChIKey | IKZCZISYUXDSJF-QMMMGPOBSA-N |
| XLogP | 3.44 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|