C13H19Cl2FN2O2 — CID 120966941
[4-[2-(2-chloro-4-fluorophenoxy)ethyl]morpholin-2-yl]methanamine;hydrochloride (PubChem CID 120966941) has the molecular formula C13H19Cl2FN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is [4-[2-(2-chloro-4-fluorophenoxy)ethyl]morpholin-2-yl]methanamine;hydrochloride.
| Compound Name | [4-[2-(2-chloro-4-fluorophenoxy)ethyl]morpholin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120966941 |
| Molecular Formula | C13H19Cl2FN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | [4-[2-(2-chloro-4-fluorophenoxy)ethyl]morpholin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CN(CCOc2ccc(F)cc2Cl)CCO1 |
| InChI | InChI=1S/C13H18ClFN2O2.ClH/c14-12-7-10(15)1-2-13(12)19-6-4-17-3-5-18-11(8-16)9-17;/h1-2,7,11H,3-6,8-9,16H2;1H |
| InChIKey | KCIFXXYCNPJOQU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |