C15H20ClFN2O — CID 120966865
2-[2-(2-chloro-4-fluorophenoxy)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 120966865) has the molecular formula C15H20ClFN2O and a molecular weight of 298.79 g/mol. Its IUPAC name is 2-[2-(2-chloro-4-fluorophenoxy)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | 2-[2-(2-chloro-4-fluorophenoxy)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 120966865 |
| Molecular Formula | C15H20ClFN2O |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[2-(2-chloro-4-fluorophenoxy)ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | NC1CCC2CN(CCOc3ccc(F)cc3Cl)CC12 |
| InChI | InChI=1S/C15H20ClFN2O/c16-13-7-11(17)2-4-15(13)20-6-5-19-8-10-1-3-14(18)12(10)9-19/h2,4,7,10,12,14H,1,3,5-6,8-9,18H2 |
| InChIKey | IIKRESXXQFIFFA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |