C14H19ClFNO2 — CID 111463147
[1-[2-(2-chloro-4-fluorophenoxy)ethyl]piperidin-3-yl]methanol (PubChem CID 111463147) has the molecular formula C14H19ClFNO2 and a molecular weight of 287.76 g/mol. Its IUPAC name is [1-[2-(2-chloro-4-fluorophenoxy)ethyl]piperidin-3-yl]methanol.
| Compound Name | [1-[2-(2-chloro-4-fluorophenoxy)ethyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 111463147 |
| Molecular Formula | C14H19ClFNO2 |
| Molecular Weight | 287.76 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | [1-[2-(2-chloro-4-fluorophenoxy)ethyl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(CCOc2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C14H19ClFNO2/c15-13-8-12(16)3-4-14(13)19-7-6-17-5-1-2-11(9-17)10-18/h3-4,8,11,18H,1-2,5-7,9-10H2 |
| InChIKey | XLDRYCYVBGMVMG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |