C16H17O3S- — CID 18989047
1-cyclohexylnaphthalene-2-sulfonate (PubChem CID 18989047) has the molecular formula C16H17O3S- and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-cyclohexylnaphthalene-2-sulfonate.
| Compound Name | 1-cyclohexylnaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 18989047 |
| Molecular Formula | C16H17O3S- |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-cyclohexylnaphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2ccccc2c1C1CCCCC1 |
| InChI | InChI=1S/C16H18O3S/c17-20(18,19)15-11-10-12-6-4-5-9-14(12)16(15)13-7-2-1-3-8-13/h4-6,9-11,13H,1-3,7-8H2,(H,17,18,19)/p-1 |
| InChIKey | DFXMGTWFSGTXJZ-UHFFFAOYSA-M |
| XLogP | 3.79 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|