C23H18N2O6 — CID 71714269
dimethyl 3-(4-nitrophenyl)-3,4-dihydrobenzo[f]quinoline-1,2-dicarboxylate (PubChem CID 71714269) has the molecular formula C23H18N2O6 and a molecular weight of 418.41 g/mol. Its IUPAC name is dimethyl 3-(4-nitrophenyl)-3,4-dihydrobenzo[f]quinoline-1,2-dicarboxylate.
| Compound Name | dimethyl 3-(4-nitrophenyl)-3,4-dihydrobenzo[f]quinoline-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71714269 |
| Molecular Formula | C23H18N2O6 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | dimethyl 3-(4-nitrophenyl)-3,4-dihydrobenzo[f]quinoline-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(c2ccc([N+](=O)[O-])cc2)Nc2ccc3ccccc3c21 |
| InChI | InChI=1S/C23H18N2O6/c1-30-22(26)19-18-16-6-4-3-5-13(16)9-12-17(18)24-21(20(19)23(27)31-2)14-7-10-15(11-8-14)25(28)29/h3-12,21,24H,1-2H3 |
| InChIKey | PPGHLIPZYRKDMF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|