C18H27N3OS2 — CID 74241674
N-(2-ethylsulfanylphenyl)-4-(thian-4-yl)piperazine-1-carboxamide (PubChem CID 74241674) has the molecular formula C18H27N3OS2 and a molecular weight of 365.57 g/mol. Its IUPAC name is N-(2-ethylsulfanylphenyl)-4-(thian-4-yl)piperazine-1-carboxamide.
| Compound Name | N-(2-ethylsulfanylphenyl)-4-(thian-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 74241674 |
| Molecular Formula | C18H27N3OS2 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-(2-ethylsulfanylphenyl)-4-(thian-4-yl)piperazine-1-carboxamide |
| SMILES | CCSc1ccccc1NC(=O)N1CCN(C2CCSCC2)CC1 |
| InChI | InChI=1S/C18H27N3OS2/c1-2-24-17-6-4-3-5-16(17)19-18(22)21-11-9-20(10-12-21)15-7-13-23-14-8-15/h3-6,15H,2,7-14H2,1H3,(H,19,22) |
| InChIKey | LXMQGDNBMCEFIU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |