C16H24N2O2S — CID 95326985
(3S)-N-(2-ethylsulfanylphenyl)-3-(2-hydroxyethyl)piperidine-1-carboxamide (PubChem CID 95326985) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is (3S)-N-(2-ethylsulfanylphenyl)-3-(2-hydroxyethyl)piperidine-1-carboxamide.
| Compound Name | (3S)-N-(2-ethylsulfanylphenyl)-3-(2-hydroxyethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95326985 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (3S)-N-(2-ethylsulfanylphenyl)-3-(2-hydroxyethyl)piperidine-1-carboxamide |
| SMILES | CCSc1ccccc1NC(=O)N1CCC[C@@H](CCO)C1 |
| InChI | InChI=1S/C16H24N2O2S/c1-2-21-15-8-4-3-7-14(15)17-16(20)18-10-5-6-13(12-18)9-11-19/h3-4,7-8,13,19H,2,5-6,9-12H2,1H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | FTKKKDKEVQUELD-ZDUSSCGKSA-N |
| XLogP | 3.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |