C13H18F2IN3O — CID 68934679
N-(3,5-difluorophenyl)-4,4-dimethylpiperazin-4-ium-1-carboxamide iodide (PubChem CID 68934679) has the molecular formula C13H18F2IN3O and a molecular weight of 397.21 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-4,4-dimethylpiperazin-4-ium-1-carboxamide iodide.
| Compound Name | N-(3,5-difluorophenyl)-4,4-dimethylpiperazin-4-ium-1-carboxamide iodide |
|---|---|
| PubChem CID | 68934679 |
| Molecular Formula | C13H18F2IN3O |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | N-(3,5-difluorophenyl)-4,4-dimethylpiperazin-4-ium-1-carboxamide iodide |
| SMILES | C[N+]1(C)CCN(C(=O)Nc2cc(F)cc(F)c2)CC1.[I-] |
| InChI | InChI=1S/C13H17F2N3O.HI/c1-18(2)5-3-17(4-6-18)13(19)16-12-8-10(14)7-11(15)9-12;/h7-9H,3-6H2,1-2H3;1H |
| InChIKey | KCKOLUURWHIUEP-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|