C17H19N5O3S2 — CID 9496380
(1-ethylbenzotriazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 9496380) has the molecular formula C17H19N5O3S2 and a molecular weight of 405.51 g/mol. Its IUPAC name is (1-ethylbenzotriazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (1-ethylbenzotriazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 9496380 |
| Molecular Formula | C17H19N5O3S2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (1-ethylbenzotriazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | CCn1nnc2cc(C(=O)N3CCN(S(=O)(=O)c4cccs4)CC3)ccc21 |
| InChI | InChI=1S/C17H19N5O3S2/c1-2-22-15-6-5-13(12-14(15)18-19-22)17(23)20-7-9-21(10-8-20)27(24,25)16-4-3-11-26-16/h3-6,11-12H,2,7-10H2,1H3 |
| InChIKey | RAUOVRITQMFEDU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |