C17H22N4O4S2 — CID 38068227
2-butyl-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyridazin-3-one (PubChem CID 38068227) has the molecular formula C17H22N4O4S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-butyl-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyridazin-3-one.
| Compound Name | 2-butyl-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyridazin-3-one |
|---|---|
| PubChem CID | 38068227 |
| Molecular Formula | C17H22N4O4S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-butyl-6-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)pyridazin-3-one |
| SMILES | CCCCn1nc(C(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)ccc1=O |
| InChI | InChI=1S/C17H22N4O4S2/c1-2-3-8-21-15(22)7-6-14(18-21)17(23)19-9-11-20(12-10-19)27(24,25)16-5-4-13-26-16/h4-7,13H,2-3,8-12H2,1H3 |
| InChIKey | NLGJBIOHUKYCMW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |