C21H29N3O3S2 — CID 26894111
N-[4-[ethyl(propan-2-yl)amino]phenyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 26894111) has the molecular formula C21H29N3O3S2 and a molecular weight of 435.62 g/mol. Its IUPAC name is N-[4-[ethyl(propan-2-yl)amino]phenyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[4-[ethyl(propan-2-yl)amino]phenyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26894111 |
| Molecular Formula | C21H29N3O3S2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[4-[ethyl(propan-2-yl)amino]phenyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CCN(c1ccc(NC(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)cc1)C(C)C |
| InChI | InChI=1S/C21H29N3O3S2/c1-4-24(16(2)3)19-9-7-18(8-10-19)22-21(25)17-11-13-23(14-12-17)29(26,27)20-6-5-15-28-20/h5-10,15-17H,4,11-14H2,1-3H3,(H,22,25) |
| InChIKey | UHWUKSXLOJGEID-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |