C10H12N2O4S2 — CID 86798672
1-methyl-2-oxo-N-thiophen-2-ylsulfonylpyrrolidine-3-carboxamide (PubChem CID 86798672) has the molecular formula C10H12N2O4S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-thiophen-2-ylsulfonylpyrrolidine-3-carboxamide.
| Compound Name | 1-methyl-2-oxo-N-thiophen-2-ylsulfonylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 86798672 |
| Molecular Formula | C10H12N2O4S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 1-methyl-2-oxo-N-thiophen-2-ylsulfonylpyrrolidine-3-carboxamide |
| SMILES | CN1CCC(C(=O)NS(=O)(=O)c2cccs2)C1=O |
| InChI | InChI=1S/C10H12N2O4S2/c1-12-5-4-7(10(12)14)9(13)11-18(15,16)8-3-2-6-17-8/h2-3,6-7H,4-5H2,1H3,(H,11,13) |
| InChIKey | WDPACHXEQWUASZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|