C24H21N3O4S2 — CID 46466645
N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 46466645) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 46466645 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NCc1ccc(OCc2cccnc2)cc1)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C24H21N3O4S2/c28-24(20-7-9-21(10-8-20)27-33(29,30)23-4-2-14-32-23)26-16-18-5-11-22(12-6-18)31-17-19-3-1-13-25-15-19/h1-15,27H,16-17H2,(H,26,28) |
| InChIKey | JQIOIPIOIKMYIJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |