C18H16N2O2S2 — CID 55766242
N-[[4-(thiophen-3-ylmethylcarbamoyl)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 55766242) has the molecular formula C18H16N2O2S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[[4-(thiophen-3-ylmethylcarbamoyl)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-(thiophen-3-ylmethylcarbamoyl)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55766242 |
| Molecular Formula | C18H16N2O2S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-[[4-(thiophen-3-ylmethylcarbamoyl)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccsc1)c1ccc(CNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H16N2O2S2/c21-17(19-11-14-7-9-23-12-14)15-5-3-13(4-6-15)10-20-18(22)16-2-1-8-24-16/h1-9,12H,10-11H2,(H,19,21)(H,20,22) |
| InChIKey | SYVDFHYFSRPYMX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |