C22H22N2O3S — CID 8660823
[2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate (PubChem CID 8660823) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8660823 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (Z)-3-(3-methylphenyl)-2-thiophen-2-ylprop-2-enoate |
| SMILES | Cc1cccc(/C=C(/C(=O)OCC(=O)N[C@](C)(C#N)C2CC2)c2cccs2)c1 |
| InChI | InChI=1S/C22H22N2O3S/c1-15-5-3-6-16(11-15)12-18(19-7-4-10-28-19)21(26)27-13-20(25)24-22(2,14-23)17-8-9-17/h3-7,10-12,17H,8-9,13H2,1-2H3,(H,24,25)/b18-12+/t22-/m1/s1 |
| InChIKey | UEPYQCSVSYCFBX-YGYUYSJASA-N |
| XLogP | 3.95 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|