C18H19BrN2O3 — CID 7881454
[2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate (PubChem CID 7881454) has the molecular formula C18H19BrN2O3 and a molecular weight of 391.27 g/mol. Its IUPAC name is [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate.
| Compound Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7881454 |
| Molecular Formula | C18H19BrN2O3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | [2-[[(1S)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)OCC(=O)N[C@](C)(C#N)C2CC2)c(Br)c1 |
| InChI | InChI=1S/C18H19BrN2O3/c1-12-3-4-13(15(19)9-12)5-8-17(23)24-10-16(22)21-18(2,11-20)14-6-7-14/h3-5,8-9,14H,6-7,10H2,1-2H3,(H,21,22)/b8-5+/t18-/m1/s1 |
| InChIKey | NAYJLUROVOHYFQ-KRZKXXONSA-N |
| XLogP | 3.12 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|