C17H13ClFNO3 — CID 2599764
(2-amino-2-oxoethyl) (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate (PubChem CID 2599764) has the molecular formula C17H13ClFNO3 and a molecular weight of 333.75 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate.
| Compound Name | (2-amino-2-oxoethyl) (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2599764 |
| Molecular Formula | C17H13ClFNO3 |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | (2-amino-2-oxoethyl) (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate |
| SMILES | NC(=O)COC(=O)/C(=C/c1ccc(Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13ClFNO3/c18-13-5-1-11(2-6-13)9-15(17(22)23-10-16(20)21)12-3-7-14(19)8-4-12/h1-9H,10H2,(H2,20,21)/b15-9+ |
| InChIKey | WXTSFTSWBXBEID-OQLLNIDSSA-N |
| XLogP | 3.05 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|