C18H14ClFO2 — CID 135254684
(1E,4E)-1-(4-chlorophenyl)-2-(4-fluorophenyl)-6-hydroxyhexa-1,4-dien-3-one (PubChem CID 135254684) has the molecular formula C18H14ClFO2 and a molecular weight of 316.76 g/mol. Its IUPAC name is (1E,4E)-1-(4-chlorophenyl)-2-(4-fluorophenyl)-6-hydroxyhexa-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(4-chlorophenyl)-2-(4-fluorophenyl)-6-hydroxyhexa-1,4-dien-3-one |
|---|---|
| PubChem CID | 135254684 |
| Molecular Formula | C18H14ClFO2 |
| Molecular Weight | 316.76 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (1E,4E)-1-(4-chlorophenyl)-2-(4-fluorophenyl)-6-hydroxyhexa-1,4-dien-3-one |
| SMILES | O=C(/C=C/CO)/C(=C/c1ccc(Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H14ClFO2/c19-15-7-3-13(4-8-15)12-17(18(22)2-1-11-21)14-5-9-16(20)10-6-14/h1-10,12,21H,11H2/b2-1+,17-12+ |
| InChIKey | CBVGBQJNKDNBLH-MGBJNMADSA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|