C28H26ClFO3 — CID 2100522
[(2S)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate (PubChem CID 2100522) has the molecular formula C28H26ClFO3 and a molecular weight of 464.96 g/mol. Its IUPAC name is [(2S)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2100522 |
| Molecular Formula | C28H26ClFO3 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [(2S)-1-(4-tert-butylphenyl)-1-oxopropan-2-yl] (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C(=C/c1ccc(Cl)cc1)c1ccc(F)cc1)C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H26ClFO3/c1-18(26(31)21-7-11-22(12-8-21)28(2,3)4)33-27(32)25(20-9-15-24(30)16-10-20)17-19-5-13-23(29)14-6-19/h5-18H,1-4H3/b25-17+/t18-/m0/s1 |
| InChIKey | FERHZOKQUUUQMJ-WLXKGNRNSA-N |
| XLogP | 7.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|