C20H19ClFNO3 — CID 2599727
[2-oxo-2-(propylamino)ethyl] (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate (PubChem CID 2599727) has the molecular formula C20H19ClFNO3 and a molecular weight of 375.83 g/mol. Its IUPAC name is [2-oxo-2-(propylamino)ethyl] (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(propylamino)ethyl] (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2599727 |
| Molecular Formula | C20H19ClFNO3 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [2-oxo-2-(propylamino)ethyl] (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoate |
| SMILES | CCCNC(=O)COC(=O)/C(=C/c1ccc(Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H19ClFNO3/c1-2-11-23-19(24)13-26-20(25)18(15-5-9-17(22)10-6-15)12-14-3-7-16(21)8-4-14/h3-10,12H,2,11,13H2,1H3,(H,23,24)/b18-12+ |
| InChIKey | VAANJTGYTIUASX-LDADJPATSA-N |
| XLogP | 4.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|