C32H32F2N4O4 — CID 175665274
1-N,4-N-bis[(E)-1-(4-fluorophenyl)-3-oxo-3-(propylamino)prop-1-en-2-yl]benzene-1,4-dicarboxamide (PubChem CID 175665274) has the molecular formula C32H32F2N4O4 and a molecular weight of 574.63 g/mol. Its IUPAC name is 1-N,4-N-bis[(E)-1-(4-fluorophenyl)-3-oxo-3-(propylamino)prop-1-en-2-yl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(E)-1-(4-fluorophenyl)-3-oxo-3-(propylamino)prop-1-en-2-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 175665274 |
| Molecular Formula | C32H32F2N4O4 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 1-N,4-N-bis[(E)-1-(4-fluorophenyl)-3-oxo-3-(propylamino)prop-1-en-2-yl]benzene-1,4-dicarboxamide |
| SMILES | CCCNC(=O)/C(=C\c1ccc(F)cc1)NC(=O)c1ccc(C(=O)N/C(=C/c2ccc(F)cc2)C(=O)NCCC)cc1 |
| InChI | InChI=1S/C32H32F2N4O4/c1-3-17-35-31(41)27(19-21-5-13-25(33)14-6-21)37-29(39)23-9-11-24(12-10-23)30(40)38-28(32(42)36-18-4-2)20-22-7-15-26(34)16-8-22/h5-16,19-20H,3-4,17-18H2,1-2H3,(H,35,41)(H,36,42)(H,37,39)(H,38,40)/b27-19+,28-20+ |
| InChIKey | OYFHBHPNZJQIBB-MKYUKRCKSA-N |
| XLogP | 4.56 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|