C19H13ClFNOS — CID 2338665
(E)-N-(4-chlorophenyl)-3-(4-fluorophenyl)-2-thiophen-3-ylprop-2-enamide (PubChem CID 2338665) has the molecular formula C19H13ClFNOS and a molecular weight of 357.84 g/mol. Its IUPAC name is (E)-N-(4-chlorophenyl)-3-(4-fluorophenyl)-2-thiophen-3-ylprop-2-enamide.
| Compound Name | (E)-N-(4-chlorophenyl)-3-(4-fluorophenyl)-2-thiophen-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 2338665 |
| Molecular Formula | C19H13ClFNOS |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (E)-N-(4-chlorophenyl)-3-(4-fluorophenyl)-2-thiophen-3-ylprop-2-enamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)/C(=C/c1ccc(F)cc1)c1ccsc1 |
| InChI | InChI=1S/C19H13ClFNOS/c20-15-3-7-17(8-4-15)22-19(23)18(14-9-10-24-12-14)11-13-1-5-16(21)6-2-13/h1-12H,(H,22,23)/b18-11+ |
| InChIKey | NHDDFSIHCUQQEV-WOJGMQOQSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|