C17H13ClFNO3S — CID 16633924
(E)-3-(4-chlorophenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylprop-2-enoic acid (PubChem CID 16633924) has the molecular formula C17H13ClFNO3S and a molecular weight of 365.81 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylprop-2-enoic acid.
| Compound Name | (E)-3-(4-chlorophenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 16633924 |
| Molecular Formula | C17H13ClFNO3S |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylprop-2-enoic acid |
| SMILES | O=C(CS/C(=C/c1ccc(Cl)cc1)C(=O)O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H13ClFNO3S/c18-12-3-1-11(2-4-12)9-15(17(22)23)24-10-16(21)20-14-7-5-13(19)6-8-14/h1-9H,10H2,(H,20,21)(H,22,23)/b15-9+ |
| InChIKey | GZAOPVRHSPBVHL-OQLLNIDSSA-N |
| XLogP | 4.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|