C18H16FNO4S — CID 16633936
(E)-3-(4-fluorophenyl)-2-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylprop-2-enoic acid (PubChem CID 16633936) has the molecular formula C18H16FNO4S and a molecular weight of 361.39 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-2-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylprop-2-enoic acid.
| Compound Name | (E)-3-(4-fluorophenyl)-2-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 16633936 |
| Molecular Formula | C18H16FNO4S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-2-[2-(4-methoxyanilino)-2-oxoethyl]sulfanylprop-2-enoic acid |
| SMILES | COc1ccc(NC(=O)CS/C(=C/c2ccc(F)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C18H16FNO4S/c1-24-15-8-6-14(7-9-15)20-17(21)11-25-16(18(22)23)10-12-2-4-13(19)5-3-12/h2-10H,11H2,1H3,(H,20,21)(H,22,23)/b16-10+ |
| InChIKey | APZDEPVRGCMUBT-MHWRWJLKSA-N |
| XLogP | 3.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|