C17H23ClN2O5 — CID 9019075
[2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate (PubChem CID 9019075) has the molecular formula C17H23ClN2O5 and a molecular weight of 370.83 g/mol. Its IUPAC name is [2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate.
| Compound Name | [2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 9019075 |
| Molecular Formula | C17H23ClN2O5 |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [2-[methyl-[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 4-(4-chloro-2-methylphenoxy)butanoate |
| SMILES | CNC(=O)CN(C)C(=O)COC(=O)CCCOc1ccc(Cl)cc1C |
| InChI | InChI=1S/C17H23ClN2O5/c1-12-9-13(18)6-7-14(12)24-8-4-5-17(23)25-11-16(22)20(3)10-15(21)19-2/h6-7,9H,4-5,8,10-11H2,1-3H3,(H,19,21) |
| InChIKey | FXVAAOXQNVLLNL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|