C16H15N5O3S — CID 109285229
5-(2-cyanoanilino)-N-(1,1-dioxothiolan-3-yl)pyrazine-2-carboxamide (PubChem CID 109285229) has the molecular formula C16H15N5O3S and a molecular weight of 357.40 g/mol. Its IUPAC name is 5-(2-cyanoanilino)-N-(1,1-dioxothiolan-3-yl)pyrazine-2-carboxamide.
| Compound Name | 5-(2-cyanoanilino)-N-(1,1-dioxothiolan-3-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109285229 |
| Molecular Formula | C16H15N5O3S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 5-(2-cyanoanilino)-N-(1,1-dioxothiolan-3-yl)pyrazine-2-carboxamide |
| SMILES | N#Cc1ccccc1Nc1cnc(C(=O)NC2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C16H15N5O3S/c17-7-11-3-1-2-4-13(11)21-15-9-18-14(8-19-15)16(22)20-12-5-6-25(23,24)10-12/h1-4,8-9,12H,5-6,10H2,(H,19,21)(H,20,22) |
| InChIKey | HVANZKVNPCJOPJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |