C22H26N2O2 — CID 109052208
1-N-cyclohexyl-3-N-ethyl-3-N-phenylbenzene-1,3-dicarboxamide (PubChem CID 109052208) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-N-cyclohexyl-3-N-ethyl-3-N-phenylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-cyclohexyl-3-N-ethyl-3-N-phenylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109052208 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-N-cyclohexyl-3-N-ethyl-3-N-phenylbenzene-1,3-dicarboxamide |
| SMILES | CCN(C(=O)c1cccc(C(=O)NC2CCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O2/c1-2-24(20-14-7-4-8-15-20)22(26)18-11-9-10-17(16-18)21(25)23-19-12-5-3-6-13-19/h4,7-11,14-16,19H,2-3,5-6,12-13H2,1H3,(H,23,25) |
| InChIKey | RMIHHHVOQQELNX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |