C16H25N3O3S — CID 109237168
N-(1,1-dioxothiolan-3-yl)-5-(dipropylamino)pyridine-3-carboxamide (PubChem CID 109237168) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-5-(dipropylamino)pyridine-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-5-(dipropylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109237168 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-5-(dipropylamino)pyridine-3-carboxamide |
| SMILES | CCCN(CCC)c1cncc(C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C16H25N3O3S/c1-3-6-19(7-4-2)15-9-13(10-17-11-15)16(20)18-14-5-8-23(21,22)12-14/h9-11,14H,3-8,12H2,1-2H3,(H,18,20) |
| InChIKey | ILUUDQSQRFLYEA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |