C24H30N4O — CID 165128942
N-cycloheptyl-3-[[(1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dienyl]amino]benzamide (PubChem CID 165128942) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is N-cycloheptyl-3-[[(1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dienyl]amino]benzamide.
| Compound Name | N-cycloheptyl-3-[[(1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dienyl]amino]benzamide |
|---|---|
| PubChem CID | 165128942 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | N-cycloheptyl-3-[[(1E,3Z)-1,4-diamino-4-phenylbuta-1,3-dienyl]amino]benzamide |
| SMILES | N/C(=C\C=C(/N)Nc1cccc(C(=O)NC2CCCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H30N4O/c25-22(18-9-4-3-5-10-18)15-16-23(26)27-21-14-8-11-19(17-21)24(29)28-20-12-6-1-2-7-13-20/h3-5,8-11,14-17,20,27H,1-2,6-7,12-13,25-26H2,(H,28,29)/b22-15-,23-16+ |
| InChIKey | ZYYSEQYTFKJYDE-XRBXDRSNSA-N |
| XLogP | 4.35 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|