C15H10ClF2NO2 — CID 67337772
N-(3-chlorophenyl)-3-(2,4-difluoro-3-hydroxyphenyl)prop-2-enamide (PubChem CID 67337772) has the molecular formula C15H10ClF2NO2 and a molecular weight of 309.70 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(2,4-difluoro-3-hydroxyphenyl)prop-2-enamide.
| Compound Name | N-(3-chlorophenyl)-3-(2,4-difluoro-3-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 67337772 |
| Molecular Formula | C15H10ClF2NO2 |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | N-(3-chlorophenyl)-3-(2,4-difluoro-3-hydroxyphenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)c(O)c1F)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H10ClF2NO2/c16-10-2-1-3-11(8-10)19-13(20)7-5-9-4-6-12(17)15(21)14(9)18/h1-8,21H,(H,19,20) |
| InChIKey | MCPRXSHVOVRGES-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|